EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | [H]C(=CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H8O4/c7-5(8)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,7,8)(H,9,10) |
| InChIKey | YHGNXQAFNHCBTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hexenedioic acid (CHEBI:87166) is a hexenedioic acid (CHEBI:25789) |
| Incoming Relation(s) |
| trans-3-hexenedioic acid (CHEBI:86952) is a 3-hexenedioic acid (CHEBI:87166) |
| IUPAC Name |
|---|
| hex-3-enedioic acid |