EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10NO2 |
| Net Charge | -1 |
| Average Mass | 188.206 |
| Monoisotopic Mass | 188.07170 |
| SMILES | Cc1cccc2nc(C(=O)[O-])c(C)c12 |
| InChI | InChI=1S/C11H11NO2/c1-6-4-3-5-8-9(6)7(2)10(12-8)11(13)14/h3-5,12H,1-2H3,(H,13,14)/p-1 |
| InChIKey | AYWHJTCRGGXKSW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethylindole-2-carboxylate (CHEBI:87160) is a monocarboxylic acid anion (CHEBI:35757) |
| 3,4-dimethylindole-2-carboxylate (CHEBI:87160) is conjugate base of 3,4-dimethylindole-2-carboxylic acid (CHEBI:87459) |
| Incoming Relation(s) |
| 3,4-dimethylindole-2-carboxylic acid (CHEBI:87459) is conjugate acid of 3,4-dimethylindole-2-carboxylate (CHEBI:87160) |
| IUPAC Name |
|---|
| 3,4-dimethyl-1H-indole-2-carboxylate |
| Synonym | Source |
|---|---|
| 3,4-dimethyl-2-indolate | ChEBI |
| Citations |
|---|