EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O2 |
| Net Charge | 0 |
| Average Mass | 364.529 |
| Monoisotopic Mass | 364.24023 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])c3ccc(OC4CCCC4)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C25H32O2/c1-3-25(26)15-13-23-22-10-8-17-16-19(27-18-6-4-5-7-18)9-11-20(17)21(22)12-14-24(23,25)2/h1,9,11,16,18,21-23,26H,4-8,10,12-15H2,2H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | PWZUUYSISTUNDW-VAFBSOEGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinestrol (CHEBI:8716) has functional parent 17β-estradiol (CHEBI:16469) |
| quinestrol (CHEBI:8716) has role xenoestrogen (CHEBI:76988) |
| quinestrol (CHEBI:8716) is a 17-hydroxy steroid (CHEBI:36838) |
| quinestrol (CHEBI:8716) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 3-(cyclopentyloxy)-17β-ethynylestra-1,3,5(10)-trien-17-ol |
| INNs | Source |
|---|---|
| quinestrol | ChemIDplus |
| quinestrolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-alpha-Ethinylestradiol 3-cyclopentyl ether | DrugBank |
| 17alpha-Ethynylestradiol 3-cyclopentyl ether | DrugBank |
| Estradiol-17-beta 3-cyclopentyl ether | DrugBank |
| Quinestrol | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Eston | DrugBank |
| Estrovis | DrugBank |
| Estrovis 4000 | DrugBank |
| Estrovister | DrugBank |
| Plestrovis | DrugBank |
| Quilea | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2342 | DrugCentral |
| C07619 | KEGG COMPOUND |
| D00576 | KEGG DRUG |
| DB04575 | DrugBank |
| HMDB0015579 | HMDB |
| LMST02010037 | LIPID MAPS |
| Quinestrol | Wikipedia |
| US3159543 | Patent |
| US3231567 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3038592 | Beilstein |
| CAS:152-43-2 | ChemIDplus |
| CAS:152-43-2 | KEGG COMPOUND |