EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31NO3 |
| Net Charge | 0 |
| Average Mass | 285.428 |
| Monoisotopic Mass | 285.23039 |
| SMILES | CCCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C16H31NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(18)17-14-16(19)20/h2-14H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | DYUGTPXLDJQBRB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | PubMed (23111557) | ||
| urine (BTO:0001419) | PubMed (23111557) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-myristoylglycine (CHEBI:87142) has functional parent tetradecanoic acid (CHEBI:28875) |
| N-myristoylglycine (CHEBI:87142) has role human blood serum metabolite (CHEBI:85234) |
| N-myristoylglycine (CHEBI:87142) has role human urinary metabolite (CHEBI:84087) |
| N-myristoylglycine (CHEBI:87142) is a N-acylglycine (CHEBI:16180) |
| N-myristoylglycine (CHEBI:87142) is a fatty amide (CHEBI:29348) |
| N-myristoylglycine (CHEBI:87142) is conjugate acid of N-myristoylglycinate (CHEBI:86500) |
| Incoming Relation(s) |
| N-myristoylglycinate (CHEBI:86500) is conjugate base of N-myristoylglycine (CHEBI:87142) |
| N-tetradecanoylglycyl group (CHEBI:133050) is substituent group from N-myristoylglycine (CHEBI:87142) |
| IUPAC Name |
|---|
| N-tetradecanoylglycine |
| Synonyms | Source |
|---|---|
| Myristoylglycine | HMDB |
| tetradecanoylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013250 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1794967 | Reaxys |
| CAS:14246-55-0 | NIST Chemistry WebBook |
| CAS:14246-55-0 | ChemIDplus |
| Citations |
|---|