EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N2O5.HCl |
| Net Charge | 0 |
| Average Mass | 474.985 |
| Monoisotopic Mass | 474.19215 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1Cc2ccccc2C[C@H]1C(=O)O.Cl |
| InChI | InChI=1S/C25H30N2O5.ClH/c1-3-32-25(31)21(14-13-18-9-5-4-6-10-18)26-17(2)23(28)27-16-20-12-8-7-11-19(20)15-22(27)24(29)30;/h4-12,17,21-22,26H,3,13-16H2,1-2H3,(H,29,30);1H/t17-,21-,22-;/m0./s1 |
| InChIKey | IBBLRJGOOANPTQ-JKVLGAQCSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinapril hydrochloride (CHEBI:8714) has part quinapril(1+) (CHEBI:141523) |
| quinapril hydrochloride (CHEBI:8714) has role antihypertensive agent (CHEBI:35674) |
| quinapril hydrochloride (CHEBI:8714) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| quinapril hydrochloride (CHEBI:8714) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (3S)-2-{(2S)-2-[(1S)-1-ethoxycarbonyl-3-phenylpropylamino]propanoyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
| (3S)-2-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
| (3S)-2-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
| Synonyms | Source |
|---|---|
| CI-906 | ChEBI |
| Quinapril hydrochloride | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Accupril | DrugBank |
| Accuprin | DrugBank |
| Accupro | DrugBank |
| Acequin | DrugBank |
| Acuitel | DrugBank |
| Hemokvin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2340 | DrugCentral |
| C07340 | KEGG COMPOUND |
| D00459 | KEGG DRUG |
| US7482361 | Patent |
| WO2004087671 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5699760 | Beilstein |
| CAS:82586-55-8 | ChemIDplus |
| CAS:82586-55-8 | KEGG COMPOUND |
| Citations |
|---|