EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N2O5 |
| Net Charge | 0 |
| Average Mass | 438.524 |
| Monoisotopic Mass | 438.21547 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1Cc2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C25H30N2O5/c1-3-32-25(31)21(14-13-18-9-5-4-6-10-18)26-17(2)23(28)27-16-20-12-8-7-11-19(20)15-22(27)24(29)30/h4-12,17,21-22,26H,3,13-16H2,1-2H3,(H,29,30)/t17-,21-,22-/m0/s1 |
| InChIKey | JSDRRTOADPPCHY-HSQYWUDLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinapril (CHEBI:8713) has role antihypertensive agent (CHEBI:35674) |
| quinapril (CHEBI:8713) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| quinapril (CHEBI:8713) has role prodrug (CHEBI:50266) |
| quinapril (CHEBI:8713) is a dicarboxylic acid monoester (CHEBI:36244) |
| quinapril (CHEBI:8713) is a ethyl ester (CHEBI:23990) |
| quinapril (CHEBI:8713) is a isoquinolines (CHEBI:24922) |
| quinapril (CHEBI:8713) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Names |
|---|
| (3S)-2-{(2S)-2-[(1S)-1-ethoxycarbonyl-3-phenylpropylamino]propanoyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| (3S)-2-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| quinapril | WHO MedNet |
| quinapril | ChemIDplus |
| quinapril | WHO MedNet |
| quinaprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (3S)-2-{N-[(2S)-1-ethoxycarbonyl-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | IUPAC |
| Quinapril | KEGG COMPOUND |
| Citations |
|---|