EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O15P2 |
| Net Charge | 0 |
| Average Mass | 546.315 |
| Monoisotopic Mass | 546.06519 |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](C)CC(=O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C16H24N2O15P2/c1-6-4-18(16(24)17-13(6)23)14-12(22)11(21)9(31-14)5-29-34(25,26)33-35(27,28)32-15-10(20)8(19)3-7(2)30-15/h4,7,9-12,14-15,20-22H,3,5H2,1-2H3,(H,25,26)(H,27,28)(H,17,23,24)/t7-,9-,10-,11-,12-,14-,15-/m1/s1 |
| InChIKey | QCYCUBSBNNSHPN-UAELIUPZSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TDP-actinospectose (CHEBI:87129) has role bacterial metabolite (CHEBI:76969) |
| TDP-actinospectose (CHEBI:87129) is a secondary α-hydroxy ketone (CHEBI:2468) |
| TDP-actinospectose (CHEBI:87129) is a TDP-sugar (CHEBI:22080) |
| TDP-actinospectose (CHEBI:87129) is conjugate acid of TDP-actinospectose(2−) (CHEBI:86408) |
| Incoming Relation(s) |
| TDP-actinospectose(2−) (CHEBI:86408) is conjugate base of TDP-actinospectose (CHEBI:87129) |
| IUPAC Name |
|---|
| 5-methyluridine 5'-[3-(4,6-dideoxy-α-D-erythro-hexopyranos-3-ulosyl) dihydrogen diphosphate] |
| Synonym | Source |
|---|---|
| TDP-3-keto-4,6-dideoxyglucose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10503719 | Reaxys |