EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O16P2 |
| Net Charge | 0 |
| Average Mass | 564.330 |
| Monoisotopic Mass | 564.07576 |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C16H26N2O16P2/c1-5-3-18(16(25)17-13(5)24)14-11(22)9(20)7(32-14)4-30-35(26,27)34-36(28,29)33-15-12(23)10(21)8(19)6(2)31-15/h3,6-12,14-15,19-23H,4H2,1-2H3,(H,26,27)(H,28,29)(H,17,24,25)/t6-,7+,8-,9+,10+,11+,12+,14+,15+/m0/s1 |
| InChIKey | DLZAXXFFRZYLDH-SIJAZLDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salmonella enterica (ncbitaxon:28901) | - | PubMed (19058170) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TDP-β-L-rhamnose (CHEBI:87126) has role bacterial metabolite (CHEBI:76969) |
| TDP-β-L-rhamnose (CHEBI:87126) is a TDP-sugar (CHEBI:22080) |
| TDP-β-L-rhamnose (CHEBI:87126) is conjugate acid of TDP-β-L-rhamnose(2−) (CHEBI:86407) |
| Incoming Relation(s) |
| TDP-β-L-rhamnose(2−) (CHEBI:86407) is conjugate base of TDP-β-L-rhamnose (CHEBI:87126) |
| IUPAC Name |
|---|
| 5-methyluridine 5'-[3-(β-L-rhamnopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| dTDP-6-deoxy-β-L-mannose | ChEBI |
| TDP-β-rhamnose | ChEBI |
| Citations |
|---|