EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87124 - 6-tuliposide B
| Formula | C11H18O9 |
| Net Charge | 0 |
| Average Mass | 294.256 |
| Monoisotopic Mass | 294.09508 |
| SMILES | C=C(C(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C11H18O9/c1-4(5(13)2-12)10(17)19-3-6-7(14)8(15)9(16)11(18)20-6/h5-9,11-16,18H,1-3H2/t5-,6-,7-,8+,9-,11?/m1/s1 |
| InChIKey | FMHJNIRDGYFPEC-CHICSPHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tulipa gesneriana (ncbitaxon:13306) | - | PubMed (25126881) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-tuliposide B (CHEBI:87124) has functional parent D-glucopyranose (CHEBI:4167) |
| 6-tuliposide B (CHEBI:87124) has role antibacterial agent (CHEBI:33282) |
| 6-tuliposide B (CHEBI:87124) has role antifungal agent (CHEBI:35718) |
| 6-tuliposide B (CHEBI:87124) has role plant metabolite (CHEBI:76924) |
| 6-tuliposide B (CHEBI:87124) is a 6-O-acyl-D-glucose (CHEBI:59475) |
| 6-tuliposide B (CHEBI:87124) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| 6-O-[(3S)-3,4-dihydroxy-2-methylidenebutanoyl]-D-glucopyranose |
| UniProt Name | Source |
|---|---|
| 6-tuliposide B | UniProt |
| Citations |
|---|