EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C=C1C(=O)OC[C@@H]1O |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-8-5(3)7/h4,6H,1-2H2/t4-/m0/s1 |
| InChIKey | BFLSLERVRLOFCX-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tulipa gesneriana (ncbitaxon:13306) | - | PubMed (25126881) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tulipalin B (CHEBI:87123) has role antibacterial agent (CHEBI:33282) |
| tulipalin B (CHEBI:87123) has role antifungal agent (CHEBI:35718) |
| tulipalin B (CHEBI:87123) has role plant metabolite (CHEBI:76924) |
| tulipalin B (CHEBI:87123) is a butan-4-olide (CHEBI:22950) |
| tulipalin B (CHEBI:87123) is a enoate ester (CHEBI:51702) |
| tulipalin B (CHEBI:87123) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R)-4-hydroxy-3-methylideneoxolan-2-one |
| Synonyms | Source |
|---|---|
| 2-methylene-3-hydroxy-γ-butyrolactone | ChEBI |
| (+)-Tulipalin B | KNApSAcK |
| α-methylene-β-hydroxy-γ-butyrolactone | ChEBI |
| UniProt Name | Source |
|---|---|
| tulipalin B | UniProt |
| Citations |
|---|