EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C=C1C(=O)OC[C@@H]1O |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-8-5(3)7/h4,6H,1-2H2/t4-/m0/s1 |
| InChIKey | BFLSLERVRLOFCX-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tulipa gesneriana (ncbitaxon:13306) | - | PubMed (25126881) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tulipalin B (CHEBI:87123) has role antibacterial agent (CHEBI:33282) |
| tulipalin B (CHEBI:87123) has role antifungal agent (CHEBI:35718) |
| tulipalin B (CHEBI:87123) has role plant metabolite (CHEBI:76924) |
| tulipalin B (CHEBI:87123) is a butan-4-olide (CHEBI:22950) |
| tulipalin B (CHEBI:87123) is a enoate ester (CHEBI:51702) |
| tulipalin B (CHEBI:87123) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R)-4-hydroxy-3-methylideneoxolan-2-one |
| Synonyms | Source |
|---|---|
| 2-methylene-3-hydroxy-γ-butyrolactone | ChEBI |
| (+)-Tulipalin B | KNApSAcK |
| α-methylene-β-hydroxy-γ-butyrolactone | ChEBI |
| UniProt Name | Source |
|---|---|
| tulipalin B | UniProt |
| Citations |
|---|