EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N2O7S2 |
| Net Charge | 0 |
| Average Mass | 458.473 |
| Monoisotopic Mass | 458.02424 |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(N=Nc3cccc4ccccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C20H14N2O7S2/c23-17-9-8-13-10-14(30(24,25)26)11-18(31(27,28)29)19(13)20(17)22-21-16-7-3-5-12-4-1-2-6-15(12)16/h1-11,23H,(H,24,25,26)(H,27,28,29) |
| InChIKey | HOQKGCIZHZIZQS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87115) is a monoazo compound (CHEBI:48959) |
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87115) is a naphthalenesulfonic acid (CHEBI:36336) |
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87115) is a naphthols (CHEBI:25392) |
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87115) is conjugate acid of 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate (CHEBI:87116) |
| Incoming Relation(s) |
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate (CHEBI:87116) is conjugate base of 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87115) |
| IUPAC Name |
|---|
| 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid |
| Synonym | Source |
|---|---|
| acid red 44 (free acid form) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8135275 | Reaxys |