EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12N2O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 502.437 |
| Monoisotopic Mass | 501.98813 |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2c(N=Nc3cccc4ccccc34)c(O)ccc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H14N2O7S2.2Na/c23-17-9-8-13-10-14(30(24,25)26)11-18(31(27,28)29)19(13)20(17)22-21-16-7-3-5-12-4-1-2-6-15(12)16;;/h1-11,23H,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | FUGCXLNGEHFIOA-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acid red 44 (CHEBI:87112) has part 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate (CHEBI:87116) |
| acid red 44 (CHEBI:87112) has role histological dye (CHEBI:77178) |
| acid red 44 (CHEBI:87112) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 7-hydroxy-8-[(naphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate |
| Synonyms | Source |
|---|---|
| Acid Leather Ponceau 6R | ChemIDplus |
| Acid Ponceau 6R | ChemIDplus |
| brilliant crystal scarlet 6R | ChEBI |
| C.I. 16250 | ChEBI |
| C.I. Acid Red 44 | ChemIDplus |
| crystal ponceau 6R | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4105519 | Reaxys |
| CAS:2766-77-0 | ChemIDplus |
| Citations |
|---|