EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O8S2 |
| Net Charge | 0 |
| Average Mass | 424.412 |
| Monoisotopic Mass | 424.00351 |
| SMILES | O=S(=O)(O)c1cc(O)c2c(O)c(N=Nc3ccccc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C16H12N2O8S2/c19-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)18-17-10-4-2-1-3-5-10/h1-8,19-20H,(H,21,22,23)(H,24,25,26) |
| InChIKey | IJDLCOIGFNUHAQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid (CHEBI:87108) is a azobenzenes (CHEBI:22682) |
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid (CHEBI:87108) is a naphthalenediols (CHEBI:23783) |
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid (CHEBI:87108) is a naphthalenesulfonic acid (CHEBI:36336) |
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid (CHEBI:87108) is conjugate acid of 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate (CHEBI:87111) |
| Incoming Relation(s) |
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate (CHEBI:87111) is conjugate base of 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid (CHEBI:87108) |
| IUPAC Name |
|---|
| 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonic acid |
| Synonym | Source |
|---|---|
| acid red 29 (free acid form) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1917652 | Reaxys |