EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10N2O8S2.2Na |
| Net Charge | 0 |
| Average Mass | 468.376 |
| Monoisotopic Mass | 467.96740 |
| SMILES | O=S(=O)([O-])c1cc(O)c2c(O)c(N=Nc3ccccc3)c(S(=O)(=O)[O-])cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O8S2.2Na/c19-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)18-17-10-4-2-1-3-5-10;;/h1-8,19-20H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2 |
| InChIKey | GXEAXHYQKZAJGB-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acid red 29 (CHEBI:87106) has part 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate (CHEBI:87111) |
| acid red 29 (CHEBI:87106) has role histological dye (CHEBI:77178) |
| acid red 29 (CHEBI:87106) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 4,5-dihydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate |
| Synonyms | Source |
|---|---|
| 3-(phenylazo)chromotropic acid, disodium salt | ChEBI |
| Acid Chromotrope 2R | ChemIDplus |
| Acilan chromotrope RR | ChemIDplus |
| Brasilan Fast fuchsine G | ChemIDplus |
| carmoisine 6R | ChEBI |
| chromotrope 2R | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7616654 | Reaxys |
| CAS:4197-07-3 | ChemIDplus |
| Citations |
|---|