EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O7S2 |
| Net Charge | 0 |
| Average Mass | 436.467 |
| Monoisotopic Mass | 436.03989 |
| SMILES | Cc1ccc(N=Nc2c(O)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)c(C)c1 |
| InChI | InChI=1S/C18H16N2O7S2/c1-10-3-6-15(11(2)7-10)19-20-17-14-5-4-13(28(22,23)24)8-12(14)9-16(18(17)21)29(25,26)27/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | YYYARFHFWYKNLF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) has role carcinogenic agent (CHEBI:50903) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) has role cardiotoxic agent (CHEBI:50912) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) is a azobenzenes (CHEBI:22682) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) is a naphthalenesulfonic acid (CHEBI:36336) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) is a naphthols (CHEBI:25392) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) is conjugate acid of 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate (CHEBI:87105) |
| Incoming Relation(s) |
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate (CHEBI:87105) is conjugate base of 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (CHEBI:87104) |
| IUPAC Name |
|---|
| 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| Synonyms | Source |
|---|---|
| 1-(2,4-Xylylazo)-2-naphthol-3,6-disulfonic acid | ChemIDplus |
| acid red 26 (free acid form) | ChEBI |
| Ponceau MX | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:728148 | Reaxys |
| CAS:7481-49-4 | ChemIDplus |
| Citations |
|---|