EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O7S2 |
| Net Charge | 0 |
| Average Mass | 408.413 |
| Monoisotopic Mass | 408.00859 |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(/N=N/c3ccccc3)c(O)ccc2c1 |
| InChI | InChI=1S/C16H12N2O7S2/c19-13-7-6-10-8-12(26(20,21)22)9-14(27(23,24)25)15(10)16(13)18-17-11-4-2-1-3-5-11/h1-9,19H,(H,20,21,22)(H,23,24,25)/b18-17+ |
| InChIKey | MPVDXIMFBOLMNW-ISLYRVAYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87092) is a azobenzenes (CHEBI:22682) |
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87092) is a naphthalenesulfonic acid (CHEBI:36336) |
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87092) is a naphthols (CHEBI:25392) |
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87092) is conjugate acid of 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonate (CHEBI:87093) |
| Incoming Relation(s) |
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonate (CHEBI:87093) is conjugate base of 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid (CHEBI:87092) |
| IUPAC Name |
|---|
| 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid |
| Synonym | Source |
|---|---|
| orange G free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1896996 | Reaxys |