EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H65NO5 |
| Net Charge | 0 |
| Average Mass | 591.918 |
| Monoisotopic Mass | 591.48627 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@]([H])([C@H](C)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CN)[C@]4([H])CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](C)CC[C@]21C |
| InChI | InChI=1S/C36H65NO5/c1-20-11-15-34(6)25(32(20,3)4)14-18-36(8)27(34)10-9-26-33(5)16-12-22(23(33)13-17-35(26,36)7)21(2)28(39)30(41)31(42)29(40)24(38)19-37/h20-31,38-42H,9-19,37H2,1-8H3/t20-,21-,22+,23-,24-,25-,26+,27+,28+,29-,30+,31-,33-,34-,35+,36+/m0/s1 |
| InChIKey | NYINOFIIAOPILH-DFPHJZBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methylococcus capsulatus (ncbitaxon:243233) | - | PubMed (22826256) | Strain: Bath |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 35-amino-3-methylbacteriohopane-30,31,32,33,34-pentol (CHEBI:87086) has role bacterial metabolite (CHEBI:76969) |
| 35-amino-3-methylbacteriohopane-30,31,32,33,34-pentol (CHEBI:87086) is a hopanoid (CHEBI:51963) |
| 35-amino-3-methylbacteriohopane-30,31,32,33,34-pentol (CHEBI:87086) is a pentol (CHEBI:37205) |
| 35-amino-3-methylbacteriohopane-30,31,32,33,34-pentol (CHEBI:87086) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (2S,3S,4R,5R,6R,7S)-1-amino-7-[(3S,3aS,5aR,5bR,7aS,9S,11aS,11bR,13aR,13bS)-5a,5b,8,8,9,11a,13b-heptamethylicosahydro-1H-cyclopenta[a]chrysen-3-yl]octane-2,3,4,5,6-pentol |
| Synonyms | Source |
|---|---|
| 3-methylaminobacteriohopanepentol | ChEBI |
| AMBHP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:99541-80-7 | ChemIDplus |
| Citations |
|---|