EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H63NO5 |
| Net Charge | 0 |
| Average Mass | 577.891 |
| Monoisotopic Mass | 577.47062 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@]([H])([C@H](C)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CN)[C@]4([H])CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C35H63NO5/c1-20(27(38)29(40)30(41)28(39)23(37)19-36)21-11-16-32(4)22(21)12-17-34(6)25(32)9-10-26-33(5)15-8-14-31(2,3)24(33)13-18-35(26,34)7/h20-30,37-41H,8-19,36H2,1-7H3/t20-,21+,22-,23-,24-,25+,26+,27+,28-,29+,30-,32-,33-,34+,35+/m0/s1 |
| InChIKey | NSCULDDFRWOMLE-IYFNNQAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methylococcus capsulatus (ncbitaxon:243233) | - | PubMed (22826256) | Strain: Bath |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 35-aminobacteriohopane-30,31,32,33,34-pentol (CHEBI:87085) has role bacterial metabolite (CHEBI:76969) |
| 35-aminobacteriohopane-30,31,32,33,34-pentol (CHEBI:87085) is a hopanoid (CHEBI:51963) |
| 35-aminobacteriohopane-30,31,32,33,34-pentol (CHEBI:87085) is a pentol (CHEBI:37205) |
| 35-aminobacteriohopane-30,31,32,33,34-pentol (CHEBI:87085) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (2S,3S,4R,5R,6R,7S)-1-amino-7-[(3S,3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethylicosahydro-1H-cyclopenta[a]chrysen-3-yl]octane-2,3,4,5,6-pentol |
| Synonym | Source |
|---|---|
| aminobacteriohopanepentol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPR04000009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:99541-79-4 | ChemIDplus |
| Citations |
|---|