EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H34N2O9S3.2Na |
| Net Charge | 0 |
| Average Mass | 792.865 |
| Monoisotopic Mass | 792.12218 |
| SMILES | CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)[O-])c3)C=C2)c2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C37H36N2O9S3.2Na/c1-3-38(25-27-7-5-9-35(23-27)50(43,44)45)32-17-11-29(12-18-32)37(31-15-21-34(22-16-31)49(40,41)42)30-13-19-33(20-14-30)39(4-2)26-28-8-6-10-36(24-28)51(46,47)48;;/h5-24H,3-4,25-26H2,1-2H3,(H2-,40,41,42,43,44,45,46,47,48);;/q;2*+1/p-2 |
| InChIKey | DGOBMKYRQHEFGQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acid green 5 (CHEBI:87065) has part acid green 5(2−) (CHEBI:87072) |
| acid green 5 (CHEBI:87065) has role histological dye (CHEBI:77178) |
| acid green 5 (CHEBI:87065) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 3-[(ethyl{4-[(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)(4-sulfonatophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene}azaniumyl)methyl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Acidal Light Green SF | ChemIDplus |
| Acid Brilliant Green SF | ChemIDplus |
| Acid green | ChEBI |
| Acid Green A | ChemIDplus |
| Acilan Green SFG | ChemIDplus |
| A F Green No.2 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15416588 | Reaxys |
| Reaxys:5717828 | Reaxys |
| CAS:5141-20-8 | ChemIDplus |