EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17N3O9S3.2Na |
| Net Charge | 0 |
| Average Mass | 585.549 |
| Monoisotopic Mass | 584.99223 |
| SMILES | Cc1cc(/C(=C2/C=CC(=[NH2+])C(S(=O)(=O)[O-])=C2)c2ccc(N)c(S(=O)(=O)[O-])c2)cc(S(=O)(=O)[O-])c1N.[Na+].[Na+] |
| InChI | InChI=1S/C20H19N3O9S3.2Na/c1-10-6-13(9-18(20(10)23)35(30,31)32)19(11-2-4-14(21)16(7-11)33(24,25)26)12-3-5-15(22)17(8-12)34(27,28)29;;/h2-9,21H,22-23H2,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2/b19-11-,21-14?;; |
| InChIKey | RZUBARUFLYGOGC-MTHOTQAESA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acid fuchsin (CHEBI:87052) has part acid fuchsin(2−) (CHEBI:87062) |
| acid fuchsin (CHEBI:87052) has role histological dye (CHEBI:77178) |
| acid fuchsin (CHEBI:87052) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 2-amino-5-[(4-amino-3-sulfonatophenyl)(4-iminio-3-sulfonatocyclohexa-2,5-dien-1-ylidene)methyl]-3-methylbenzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| acid magenta | ChEBI |
| acid roseine | ChEBI |
| acid rubin | ChEBI |
| acid violet 19 | ChEBI |
| C.I. 42685 | ChEBI |
| C.I. Acid Violet 19 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Acid_fuchsin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13196402 | Reaxys |
| CAS:68109-73-9 | ChemIDplus |
| Citations |
|---|