EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H38N6O7 |
| Net Charge | 0 |
| Average Mass | 450.537 |
| Monoisotopic Mass | 450.28020 |
| SMILES | CO[C@@H]1CO[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)C[C@H](O)[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](N)[C@H]1N |
| InChI | InChI=1S/C18H38N6O7/c1-27-10-5-28-17(13(24)12(10)23)30-15-7(20)3-8(21)16(14(15)26)31-18-11(22)9(25)2-6(4-19)29-18/h6-18,25-26H,2-5,19-24H2,1H3/t6-,7+,8-,9-,10+,11+,12-,13+,14+,15-,16+,17+,18+/m0/s1 |
| InChIKey | HJKXMQLJTKUBMG-BAOVJYBRSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial drug A drug used to treat or prevent microbial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antimicrobial drug A drug used to treat or prevent microbial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seldomycin 5 (CHEBI:87042) has role antimicrobial drug (CHEBI:36043) |
| seldomycin 5 (CHEBI:87042) has role bacterial metabolite (CHEBI:76969) |
| seldomycin 5 (CHEBI:87042) is a amino cyclitol glycoside (CHEBI:22479) |
| seldomycin 5 (CHEBI:87042) is a aminoglycoside antibiotic (CHEBI:22507) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-3-[(2,3-diamino-2,3-dideoxy-4-O-methyl-α-D-xylopyranosyl)oxy]-2-hydroxycyclohexyl 2,6-diamino-2,4,6-trideoxy-α-D-xylo-hexopyranoside |
| Manual Xrefs | Databases |
|---|---|
| US4189569 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:75635-18-6 | ChemIDplus |
| Citations |
|---|