EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H54O4 |
| Net Charge | 0 |
| Average Mass | 634.901 |
| Monoisotopic Mass | 634.40221 |
| SMILES | [H]C(C(=O)Oc1cc(C)cc(O)c1CCCCCCCCCCCC)=C([H])C([H])=C([H])C([H])=C([H])C([H])=C([H])C([H])=C([H])C([H])=C([H])C([H])=C([H])C([H])=C([H])c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C43H54O4/c1-4-5-6-7-8-9-17-20-23-26-29-39-41(45)33-36(2)34-42(39)47-43(46)30-27-24-21-18-15-13-11-10-12-14-16-19-22-25-28-38-31-32-40(44)37(3)35-38/h10-16,18-19,21-22,24-25,27-28,30-35,44-45H,4-9,17,20,23,26,29H2,1-3H3 |
| InChIKey | GFNJWVBJKYYUIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flexibacter elegans (ncbitaxon:997) | - | PubMed (4217145) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flexirubin (CHEBI:87031) is a flexirubins (CHEBI:87032) |
| IUPAC Name |
|---|
| 2-dodecyl-3-hydroxy-5-methylphenyl 17-(4-hydroxy-3-methylphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3026434 | Reaxys |
| CAS:54363-90-5 | ChemIDplus |
| Citations |
|---|