EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F3NO |
| Net Charge | +1 |
| Average Mass | 310.339 |
| Monoisotopic Mass | 310.14133 |
| SMILES | C[NH2+]CC[C@H](Oc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | RTHCYVBBDHJXIQ-INIZCTEOSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-fluoxetine(1+) (CHEBI:86995) is a ammonium ion derivative (CHEBI:35274) |
| (S)-fluoxetine(1+) (CHEBI:86995) is a organic cation (CHEBI:25697) |
| (S)-fluoxetine(1+) (CHEBI:86995) is conjugate acid of (S)-fluoxetine (CHEBI:86992) |
| (S)-fluoxetine(1+) (CHEBI:86995) is enantiomer of (R)-fluoxetine(1+) (CHEBI:86993) |
| Incoming Relation(s) |
| (S)-fluoxetine hydrochloride (CHEBI:86997) has part (S)-fluoxetine(1+) (CHEBI:86995) |
| (S)-fluoxetine (CHEBI:86992) is conjugate base of (S)-fluoxetine(1+) (CHEBI:86995) |
| (R)-fluoxetine(1+) (CHEBI:86993) is enantiomer of (S)-fluoxetine(1+) (CHEBI:86995) |
| IUPAC Name |
|---|
| (3S)-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-aminium |
| Synonym | Source |
|---|---|
| (−)-fluoxetine(1+) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25263174 | Reaxys |