EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5NO4S |
| Net Charge | 0 |
| Average Mass | 211.198 |
| Monoisotopic Mass | 210.99393 |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C8H5NO4S/c10-9(11)7-2-1-6-3-4-14(12,13)8(6)5-7/h1-5H |
| InChIKey | ZRRGOUHITGRLBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | STAT3 inhibitor An inhibitor of signal transducer and activator of transcription 3 (STAT3) |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stattic (CHEBI:86989) has role antineoplastic agent (CHEBI:35610) |
| stattic (CHEBI:86989) has role radiosensitizing agent (CHEBI:132992) |
| stattic (CHEBI:86989) has role STAT3 inhibitor (CHEBI:87183) |
| stattic (CHEBI:86989) is a C-nitro compound (CHEBI:35716) |
| stattic (CHEBI:86989) is a 1-benzothiophenes (CHEBI:38836) |
| stattic (CHEBI:86989) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 6-nitro-1H-1-benzothiophene-1,1-dione |
| Synonyms | Source |
|---|---|
| 6-nitro-1-benzothiophene 1,1-dioxide | SUBMITTER |
| CHEMBL1337170 | SUBMITTER |
| STAT3 Inhibitor V | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11410 | Reaxys |
| Citations |
|---|