EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | CCCCCCCCCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C16H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h2-14H2,1H3,(H,18,19) |
| InChIKey | ZVNHILZUTNYFGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohexadecanoic acid (CHEBI:86988) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2-oxohexadecanoic acid (CHEBI:86988) is a long-chain fatty acid (CHEBI:15904) |
| 2-oxohexadecanoic acid (CHEBI:86988) is a oxo fatty acid (CHEBI:59644) |
| 2-oxohexadecanoic acid (CHEBI:86988) is a straight-chain fatty acid (CHEBI:59202) |
| 2-oxohexadecanoic acid (CHEBI:86988) is conjugate acid of 2-oxohexadecanoate (CHEBI:176593) |
| Incoming Relation(s) |
| 2-oxohexadecanoate (CHEBI:176593) is conjugate base of 2-oxohexadecanoic acid (CHEBI:86988) |
| IUPAC Name |
|---|
| 2-oxohexadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-ketohexadecanoic acid | ChEBI |
| 2-keto palmitic acid | LIPID MAPS |
| 2-ketopalmitic acid | ChEBI |
| 2-oxo-hexadecanoic acid | LIPID MAPS |
| 2oxo-PALM | SUBMITTER |
| 2-oxopalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060050 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1784764 | Reaxys |