EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11ClF4N2S |
| Net Charge | 0 |
| Average Mass | 386.801 |
| Monoisotopic Mass | 386.02676 |
| SMILES | Fc1ccccc1C1=NCC(=S)N(CC(F)(F)F)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H11ClF4N2S/c18-10-5-6-14-12(7-10)16(11-3-1-2-4-13(11)19)23-8-15(25)24(14)9-17(20,21)22/h1-7H,8-9H2 |
| InChIKey | IKMPWMZBZSAONZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Quazepam (CHEBI:8694) is a benzodiazepine (CHEBI:22720) |
| Synonyms | Source |
|---|---|
| NSC-309702 | ChEMBL |
| prosedar | DrugCentral |
| Quazepam | KEGG COMPOUND |
| Quazepam civ | ChEMBL |
| quazium | DrugCentral |
| Sch 16134 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2336 | DrugCentral |
| C07336 | KEGG COMPOUND |
| D00457 | KEGG DRUG |
| HMDB0015528 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:36735-22-5 | KEGG COMPOUND |
| Citations |
|---|