EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H14O6.2C26H28N3 |
| Net Charge | 0 |
| Average Mass | 1151.421 |
| Monoisotopic Mass | 1150.53568 |
| SMILES | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1.Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1.O=C([O-])c1cc2ccccc2c(Cc2c(O)c(C(=O)[O-])cc3ccccc23)c1O |
| InChI | InChI=1S/2C26H28N3.C23H16O6/c2*1-19-17-21(20(2)29(19)24-9-7-6-8-10-24)11-13-23-14-12-22-18-25(27(3)4)15-16-26(22)28(23)5;24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29/h2*6-18H,1-5H3;1-10,24-25H,11H2,(H,26,27)(H,28,29)/q2*+1;/p-2 |
| InChIKey | OOPDAHSJBRZRPH-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrvinium pamoate (CHEBI:8688) has role anticoronaviral agent (CHEBI:149553) |
| Pyrvinium pamoate (CHEBI:8688) has role antineoplastic agent (CHEBI:35610) |
| Pyrvinium pamoate (CHEBI:8688) is a naphthoic acid (CHEBI:25483) |
| Synonyms | Source |
|---|---|
| NSC-223622 | ChEMBL |
| Povan | KEGG COMPOUND |
| Pyrvinium (as embonate) | ChEMBL |
| Pyrvinium pamoate | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Poquil | ChEMBL |
| Vanquil | ChEMBL |
| Vanquin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00489 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:3546-41-6 | KEGG COMPOUND |
| Citations |
|---|