EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N3 |
| Net Charge | +1 |
| Average Mass | 382.531 |
| Monoisotopic Mass | 382.22777 |
| SMILES | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H28N3/c1-19-17-21(20(2)29(19)24-9-7-6-8-10-24)11-13-23-14-12-22-18-25(27(3)4)15-16-26(22)28(23)5/h6-18H,1-5H3/q+1 |
| InChIKey | QMHSXPLYMTVAMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrvinium (CHEBI:8687) has role anthelminthic drug (CHEBI:35443) |
| pyrvinium (CHEBI:8687) has role antineoplastic agent (CHEBI:35610) |
| pyrvinium (CHEBI:8687) is a quinolinium ion (CHEBI:52837) |
| IUPAC Name |
|---|
| 6-(dimethylamino)-2-[(E)-2-(2,5-dimethyl-1-phenyl-1H-pyrrol-3-yl)ethenyl]-1-methylquinolinium |
| Citations |
|---|