EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O.Cl |
| Net Charge | 0 |
| Average Mass | 302.805 |
| Monoisotopic Mass | 302.11859 |
| SMILES | CN(C)c1ccc2cc3ccc(=[N+](C)C)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | INCIMLINXXICKS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyronin Y (CHEBI:8682) has part pyronin Y cation (CHEBI:90416) |
| pyronin Y (CHEBI:8682) has role histological dye (CHEBI:77178) |
| pyronin Y (CHEBI:8682) is a iminium salt (CHEBI:35277) |
| pyronin Y (CHEBI:8682) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 6-(dimethylamino)-N,N-dimethyl-3H-xanthen-3-iminium chloride |
| Synonyms | Source |
|---|---|
| 3,6-Bis(dimethylamino)xanthylium chloride | ChemIDplus |
| C.I. 45005 | ChemIDplus |
| Pyronine | KEGG COMPOUND |
| Pyronine Y | KEGG COMPOUND |
| Pyronin G | ChEBI |
| Pyronin Yellow | ChemIDplus |
| Citations |
|---|