EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | Cc1ncc(CO)c(CO)c1O |
| InChI | InChI=1S/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3 |
| InChIKey | LXNHXLLTXMVWPM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| - | MetaboLights (MTBLS290) | From MetaboLights | |
| - | MetaboLights (MTBLS152) | From MetaboLights | |
| blood (UBERON:0000178) | PubMed (16690736) | ||
| urine (BTO:0001419) | PubMed (22932811) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticonvulsant A drug used to prevent seizures or reduce their severity. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxine (CHEBI:16709) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxine (CHEBI:16709) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxine (CHEBI:16709) has role anti-anaemic agent (CHEBI:75835) |
| pyridoxine (CHEBI:16709) has role anti-HIV agent (CHEBI:64946) |
| pyridoxine (CHEBI:16709) has role antiatherosclerotic agent (CHEBI:145947) |
| pyridoxine (CHEBI:16709) has role anticonvulsant (CHEBI:35623) |
| pyridoxine (CHEBI:16709) has role antiemetic (CHEBI:50919) |
| pyridoxine (CHEBI:16709) has role antineoplastic agent (CHEBI:35610) |
| pyridoxine (CHEBI:16709) has role antipsychotic agent (CHEBI:35476) |
| pyridoxine (CHEBI:16709) has role antispasmodic drug (CHEBI:53784) |
| pyridoxine (CHEBI:16709) has role antitubercular agent (CHEBI:33231) |
| pyridoxine (CHEBI:16709) has role antiviral agent (CHEBI:22587) |
| pyridoxine (CHEBI:16709) has role bone density conservation agent (CHEBI:50646) |
| pyridoxine (CHEBI:16709) has role cardiovascular drug (CHEBI:35554) |
| pyridoxine (CHEBI:16709) has role cofactor (CHEBI:23357) |
| pyridoxine (CHEBI:16709) has role human metabolite (CHEBI:77746) |
| pyridoxine (CHEBI:16709) has role hypoglycemic agent (CHEBI:35526) |
| pyridoxine (CHEBI:16709) has role mouse metabolite (CHEBI:75771) |
| pyridoxine (CHEBI:16709) has role renoprotective agent (CHEBI:231911) |
| pyridoxine (CHEBI:16709) is a hydroxymethylpyridine (CHEBI:38196) |
| pyridoxine (CHEBI:16709) is a methylpyridines (CHEBI:25340) |
| pyridoxine (CHEBI:16709) is a monohydroxypyridine (CHEBI:38182) |
| pyridoxine (CHEBI:16709) is a vitamin B6 (CHEBI:27306) |
| Incoming Relation(s) |
| 5'-O-β-D-glucosylpyridoxine (CHEBI:17382) has functional parent pyridoxine (CHEBI:16709) |
| pyridoxine 5'-phosphate (CHEBI:28803) has functional parent pyridoxine (CHEBI:16709) |
| pyridoxine hydrochloride (CHEBI:30961) has part pyridoxine (CHEBI:16709) |
| IUPAC Name |
|---|
| 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol |
| INNs | Source |
|---|---|
| pyridoxina | WHO MedNet |
| pyridoxine | WHO MedNet |
| pyridoxine | WHO MedNet |
| pyridoxinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-methyl-3-hydroxy-4,5-bis(hydroxymethyl)pyridine | ChemIDplus |
| 2-Methyl-3-hydroxy-4,5-dihydroxymethyl-pyridin | ChemIDplus |
| 2-methyl-3-hydroxy-4,5-di(hydroxymethyl)pyridine | ChemIDplus |
| 2-methyl-3-hydroxy-4,5-dihydroxymethylpyridine | NIST Chemistry WebBook |
| 2-methyl-4,5-bis(hydroxymethyl)-3-hydroxypyridine | ChemIDplus |
| 2-methyl-4,5-dimethylol-pyridin-3-ol | ChEBI |
| Brand Name | Source |
|---|---|
| Pyridoxine component of vitaped | ChEMBL |
| UniProt Name | Source |
|---|---|
| pyridoxine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1025 | ChemSpider |
| 2836 | DrugCentral |
| C00001551 | KNApSAcK |
| C00314 | KEGG COMPOUND |
| D08454 | KEGG DRUG |
| DB00165 | DrugBank |
| FDB000574 | FooDB |
| HMDB0000239 | HMDB |
| LSM-5324 | LINCS |
| Pyridoxine | Wikipedia |
| PYRIDOXINE | MetaCyc |
| UEG | PDBeChem |
| Citations |
|---|