EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30961 - pyridoxine hydrochloride
| Formula | C8H11NO3.HCl |
| Net Charge | 0 |
| Average Mass | 205.641 |
| Monoisotopic Mass | 205.05057 |
| SMILES | Cc1ncc(CO)c(CO)c1O.Cl |
| InChI | InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H |
| InChIKey | ZUFQODAHGAHPFQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxine hydrochloride (CHEBI:30961) has part pyridoxine (CHEBI:16709) |
| pyridoxine hydrochloride (CHEBI:30961) has role anti-anaemic agent (CHEBI:75835) |
| pyridoxine hydrochloride (CHEBI:30961) has role antitubercular agent (CHEBI:33231) |
| pyridoxine hydrochloride (CHEBI:30961) is a hydrochloride (CHEBI:36807) |
| pyridoxine hydrochloride (CHEBI:30961) is a vitamin B6 (CHEBI:27306) |
| IUPAC Name |
|---|
| 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 2-methyl-3-hydroxy-4,5-bis(hydroxymethyl)pyridine hydrochloride | NIST Chemistry WebBook |
| 3-hydroxy-4,5-dimethylol-α-picoline hydrochloride | NIST Chemistry WebBook |
| 5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride | NIST Chemistry WebBook |
| NSC-36225 | ChEMBL |
| Pyridoxine chloride | ChEMBL |
| Pyridoxine hcl | ChEMBL |
| Brand Names | Source |
|---|---|
| Benadon | ChEMBL |
| Comploment continus | ChEMBL |
| Hexa-betalin | ChEMBL |
| Kent b6 | ChEMBL |
| Lyphomed | ChEMBL |
| Orovite comploment b6 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D02179 | KEGG DRUG |
| DBSALT000151 | DrugBank |
| FDB000575 | FooDB |
| Citations |
|---|