EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3.HCl |
| Net Charge | 0 |
| Average Mass | 205.641 |
| Monoisotopic Mass | 205.05057 |
| SMILES | Cc1ncc(CO)c(CO)c1O.Cl |
| InChI | InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H |
| InChIKey | ZUFQODAHGAHPFQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxine hydrochloride (CHEBI:30961) has part pyridoxine (CHEBI:16709) |
| pyridoxine hydrochloride (CHEBI:30961) is a hydrochloride (CHEBI:36807) |
| pyridoxine hydrochloride (CHEBI:30961) is a vitamin B6 (CHEBI:27306) |
| IUPAC Name |
|---|
| 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride | NIST Chemistry WebBook |
| 2-methyl-3-hydroxy-4,5-bis(hydroxymethyl)pyridine hydrochloride | NIST Chemistry WebBook |
| pyridoxol hydrochloride | NIST Chemistry WebBook |
| 3-hydroxy-4,5-dimethylol-α-picoline hydrochloride | NIST Chemistry WebBook |
| vitamin B6 hydrochloride | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| DBSALT000151 | DrugBank |
| FDB000575 | FooDB |
| D02179 | KEGG DRUG |
| Citations |
|---|