EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C9H13N2O2 |
| Net Charge | 0 |
| Average Mass | 261.119 |
| Monoisotopic Mass | 260.01604 |
| SMILES | CN(C)C(=O)Oc1ccc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1 |
| InChIKey | VNYBTNPBYXSMOO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridostigmine bromide (CHEBI:8666) has role antiparkinson drug (CHEBI:48407) |
| Pyridostigmine bromide (CHEBI:8666) has role antiviral agent (CHEBI:22587) |
| Pyridostigmine bromide (CHEBI:8666) has role cardiovascular drug (CHEBI:35554) |
| Pyridostigmine bromide (CHEBI:8666) has role gastrointestinal drug (CHEBI:55324) |
| Pyridostigmine bromide (CHEBI:8666) has role vasoconstrictor agent (CHEBI:50514) |
| Pyridostigmine bromide (CHEBI:8666) is a pyridinium salt (CHEBI:38188) |
| INNs | Source |
|---|---|
| bromure de pyridostigmine | WHO MedNet |
| bromuro de piridostigmina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Kalimin | ChEMBL |
| Kalymin | ChEMBL |
| Mestinon (TN) | KEGG COMPOUND |
| NSC-679759 | ChEMBL |
| NSC-758435 | ChEMBL |
| Pyridostigmine bromide | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Mestinon | ChEMBL |
| Mestinon 10 | ChEMBL |
| Mestinon ret | ChEMBL |
| Regonal | ChEMBL |
| Regonol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00487 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:101-26-8 | KEGG COMPOUND |
| Citations |
|---|