EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1ccc(CC(=O)O)cc1OC |
| InChI | InChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12) |
| InChIKey | WUAXWQRULBZETB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (19812218) | ||
| blood plasma (BTO_0000131) | PubMed (19812218) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoveratric acid (CHEBI:86655) has role human urinary metabolite (CHEBI:84087) |
| homoveratric acid (CHEBI:86655) has role human xenobiotic metabolite (CHEBI:76967) |
| homoveratric acid (CHEBI:86655) is a dimethoxybenzene (CHEBI:51681) |
| homoveratric acid (CHEBI:86655) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| (3,4-dimethoxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)acetic acid | ChEBI |
| 2-(3,4-dimethoxyphenyl)ethanoic acid | ChEBI |
| 3,4-dimethoxybenzeneacetic acid | HMDB |
| 3,4-dimethoxyphenylacetic acid | HMDB |
| homoveratrumic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6872 | ChemSpider |
| FDB000317 | FooDB |
| HMDB0000434 | HMDB |
| Citations |
|---|