EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O2 |
| Net Charge | +1 |
| Average Mass | 181.215 |
| Monoisotopic Mass | 181.09715 |
| SMILES | CN(C)C(=O)Oc1ccc[n+](C)c1 |
| InChI | InChI=1S/C9H13N2O2/c1-10(2)9(12)13-8-5-4-6-11(3)7-8/h4-7H,1-3H3/q+1 |
| InChIKey | RVOLLAQWKVFTGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridostigmine (CHEBI:8665) has role anti-HIV agent (CHEBI:64946) |
| Pyridostigmine (CHEBI:8665) has role hypoglycemic agent (CHEBI:35526) |
| Pyridostigmine (CHEBI:8665) has role vasoconstrictor agent (CHEBI:50514) |
| Pyridostigmine (CHEBI:8665) is a pyridinium ion (CHEBI:50334) |
| Synonyms | Source |
|---|---|
| Pyridostigmine | KEGG COMPOUND |
| pyridostigmine bromide | DrugCentral |
| Pyridostigmine cation | ChEMBL |
| pyridostigmine iodide | DrugCentral |
| Pyridostigmine ion | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2330 | DrugCentral |
| C07410 | KEGG COMPOUND |
| HMDB0014685 | HMDB |
| LSM-5770 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:155-97-5 | KEGG COMPOUND |
| Citations |
|---|