EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CCCCCCC(=O)OCC |
| InChI | InChI=1S/C9H18O2/c1-3-5-6-7-8-9(10)11-4-2/h3-8H2,1-2H3 |
| InChIKey | TVQGDYNRXLTQAP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl heptanoate (CHEBI:86618) has functional parent heptanoic acid (CHEBI:45571) |
| ethyl heptanoate (CHEBI:86618) has role metabolite (CHEBI:25212) |
| ethyl heptanoate (CHEBI:86618) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl heptanoate |
| Synonyms | Source |
|---|---|
| Enanthic acid ethyl ester | NIST Chemistry WebBook |
| Ethyl enanthate | ChemIDplus |
| Grape oil | ChemIDplus |
| heptanoic acid ethyl ester | ChEBI |
| Oenanthic ether | HMDB |
| Wine oil | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Ethyl_heptanoate | Wikipedia |
| HMDB0000798 | HMDB |
| Citations |
|---|