EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36O11 |
| Net Charge | 0 |
| Average Mass | 584.618 |
| Monoisotopic Mass | 584.22576 |
| SMILES | COc1cc(C(O)C(CO)Oc2c(OC)cc(C3OCC4C(c5ccc(O)c(OC)c5)OCC34)cc2OC)ccc1O |
| InChI | InChI=1S/C31H36O11/c1-36-23-9-16(5-7-21(23)33)28(35)27(13-32)42-31-25(38-3)11-18(12-26(31)39-4)30-20-15-40-29(19(20)14-41-30)17-6-8-22(34)24(10-17)37-2/h5-12,19-20,27-30,32-35H,13-15H2,1-4H3 |
| InChIKey | DVTIDVKFFJRCAB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euryale ferox (ncbitaxon:4414) | seed (BTO:0001226) | PubMed (21280632) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buddlenol E (CHEBI:86593) has role antioxidant (CHEBI:22586) |
| buddlenol E (CHEBI:86593) has role plant metabolite (CHEBI:76924) |
| buddlenol E (CHEBI:86593) is a guaiacols (CHEBI:134251) |
| buddlenol E (CHEBI:86593) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-2-{4-[4-(4-hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenoxy}propane-1,3-diol |
| Synonym | Source |
|---|---|
| G(8-O-4)S(8-8)G | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6553466 | Reaxys |
| Citations |
|---|