EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34O11 |
| Net Charge | 0 |
| Average Mass | 582.602 |
| Monoisotopic Mass | 582.21011 |
| SMILES | COc1cc(C(O)C(CO)Oc2c(OC)cc(C3Oc4c(OC)cc(/C=C/C=O)cc4C3CO)cc2OC)ccc1O |
| InChI | InChI=1S/C31H34O11/c1-37-23-12-18(7-8-22(23)35)28(36)27(16-34)41-31-25(39-3)13-19(14-26(31)40-4)29-21(15-33)20-10-17(6-5-9-32)11-24(38-2)30(20)42-29/h5-14,21,27-29,33-36H,15-16H2,1-4H3/b6-5+ |
| InChIKey | UYNCCRHOWNHDMT-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crataegus pinnatifida (ncbitaxon:510735) | seed (BTO:0001226) | PubMed (23845552) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buddlenol A (CHEBI:86592) has role plant metabolite (CHEBI:76924) |
| buddlenol A (CHEBI:86592) is a aldehyde (CHEBI:17478) |
| buddlenol A (CHEBI:86592) is a benzofurans (CHEBI:35259) |
| buddlenol A (CHEBI:86592) is a dimethoxybenzene (CHEBI:51681) |
| buddlenol A (CHEBI:86592) is a lignan (CHEBI:25036) |
| buddlenol A (CHEBI:86592) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (2E)-3-[2-(4-{[1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy}-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]prop-2-enal |
| Synonyms | Source |
|---|---|
| G(8-O-4)S(8-5)G' | ChEBI |
| G(8—O—4)S(8—5)G' | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00038658 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6554125 | Reaxys |
| CAS:97399-78-5 | KNApSAcK |
| Citations |
|---|