EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | CC(=O)Oc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C11H12O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-3,5-6H,4,7H2,1H3,(H,13,14) |
| InChIKey | YQPHNMWXZLUIJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4'-acetoxyphenyl)propionic acid (CHEBI:86581) is a acetate ester (CHEBI:47622) |
| 3-(4'-acetoxyphenyl)propionic acid (CHEBI:86581) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[4-(acetyloxy)phenyl]propanoic acid |
| Synonym | Source |
|---|---|
| acetylated dihydrocoumaric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2110567 | Reaxys |