EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O4 |
| Net Charge | 0 |
| Average Mass | 206.197 |
| Monoisotopic Mass | 206.05791 |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C11H10O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-4+ |
| InChIKey | BYHBHNKBISXCEP-QPJJXVBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-acetoxycinnamic acid (CHEBI:86580) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| 4-acetoxycinnamic acid (CHEBI:86580) is a cinnamic acids (CHEBI:23252) |
| 4-acetoxycinnamic acid (CHEBI:86580) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| (2E)-3-[4-(acetyloxy)phenyl]prop-2-enoic acid |
| Synonym | Source |
|---|---|
| acetylated coumaric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2806111 | Reaxys |