EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16Cl2N2O4S |
| Net Charge | 0 |
| Average Mass | 439.320 |
| Monoisotopic Mass | 438.02078 |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(=O)c3ccc(Cl)cc3Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O4S/c1-11-4-7-14(8-5-11)28(25,26)27-19-17(12(2)22-23(19)3)18(24)15-9-6-13(20)10-16(15)21/h4-10H,1-3H3 |
| InChIKey | ASRAWSBMDXVNLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrazolynate (CHEBI:8657) has role agrochemical (CHEBI:33286) |
| pyrazolynate (CHEBI:8657) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| pyrazolynate (CHEBI:8657) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| pyrazolynate (CHEBI:8657) has role proherbicide (CHEBI:136646) |
| pyrazolynate (CHEBI:8657) is a aromatic ketone (CHEBI:76224) |
| pyrazolynate (CHEBI:8657) is a dichlorobenzene (CHEBI:23697) |
| pyrazolynate (CHEBI:8657) is a pyrazoles (CHEBI:26410) |
| pyrazolynate (CHEBI:8657) is a tosylate ester (CHEBI:83351) |
| IUPAC Name |
|---|
| 4-(2,4-dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl 4-methylbenzenesulfonate |
| Synonyms | Source |
|---|---|
| (2,4-dichlorophenyl)[1,3-dimethyl-5-[[(4-methylphenyl)sulfonyl]oxy]-1H-pyrazol-4-yl]methanone | Alan Wood's Pesticides |
| 4-(2,4-dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl 4-methylbenzene-1-sulfonate | Alan Wood's Pesticides |
| 4-(2,4-Dichlorobenzoyl)-1,3-dimethyl-5-pyrazolyl p-toluenesulfonate | KEGG COMPOUND |
| 4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl toluene-4-sulfonate | Alan Wood's Pesticides |
| pyrazolate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 2766 | PPDB |
| C11123 | KEGG COMPOUND |
| pyrazolynate | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:860937 | Reaxys |
| CAS:58011-68-0 | KEGG COMPOUND |
| CAS:58011-68-0 | ChemIDplus |
| CAS:58011-68-0 | Alan Wood's Pesticides |
| Citations |
|---|