EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O2 |
| Net Charge | 0 |
| Average Mass | 145.162 |
| Monoisotopic Mass | 145.08513 |
| SMILES | NC(N)=NCCCC(=O)O |
| InChI | InChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8) |
| InChIKey | TUHVEAJXIMEOSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-guanidinobutyric acid (CHEBI:86564) is a guanidines (CHEBI:24436) |
| 4-guanidinobutyric acid (CHEBI:86564) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| 4-[(E)-{amino[(3-methylbut-2-en-1-yl)amino]methylidene}amino]butanoic acid (CHEBI:143814) has functional parent 4-guanidinobutyric acid (CHEBI:86564) |
| IUPAC Name |
|---|
| 4-carbamimidamidobutanoic acid |
| Synonyms | Source |
|---|---|
| 4-(diaminomethylideneamino)butanoic acid | ChEBI |
| 4-guanidinobutanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6717259 | Reaxys |
| CAS:463-00-3 | ChemIDplus |