EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | CC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | GDBUZIKSJGRBJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-acetoxy benzoic acid (CHEBI:86560) is a benzoic acids (CHEBI:22723) |
| 4-acetoxy benzoic acid (CHEBI:86560) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| 4-(acetyloxy)benzoic acid |
| Synonyms | Source |
|---|---|
| 4-carboxyphenyl acetate | NIST Chemistry WebBook |
| p-acetoxybenzoic acid | NIST Chemistry WebBook |
| p-hydroxybenzoic acid acetate | ChEBI |