EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | O=C(O)C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C8H8O4/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12) |
| InChIKey | OLSDAJRAVOVKLG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6788786) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxymandelic acid (CHEBI:86553) has functional parent mandelic acid (CHEBI:35825) |
| 3-hydroxymandelic acid (CHEBI:86553) has role human metabolite (CHEBI:77746) |
| 3-hydroxymandelic acid (CHEBI:86553) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 3-hydroxymandelic acid (CHEBI:86553) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| hydroxy(3-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2-(3-hydroxyphenyl)ethanoic acid | ChEBI |
| 2-hydroxy-2-(3-hydroxyphenyl)acetic acid | ChEBI |
| m-hydroxymandelic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000750 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2365378 | Reaxys |
| CAS:17119-15-2 | ChemIDplus |
| Citations |
|---|