EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9BO3 |
| Net Charge | 0 |
| Average Mass | 163.969 |
| Monoisotopic Mass | 164.06447 |
| SMILES | CC(=O)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3 |
| InChIKey | SJGGDZCTGBKBCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-acetylphenylboronic acid (CHEBI:86552) has functional parent phenylboronic acid (CHEBI:44923) |
| 3-acetylphenylboronic acid (CHEBI:86552) is a aromatic ketone (CHEBI:76224) |
| 3-acetylphenylboronic acid (CHEBI:86552) is a boronic acids (CHEBI:38269) |
| IUPAC Name |
|---|
| (3-acetylphenyl)boronic acid |
| Synonym | Source |
|---|---|
| (3-ethanoylphenyl)boronic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8255673 | Reaxys |