EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/b7-6+ |
| InChIKey | CWMPPVPFLSZGCY-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aedes albopictus (ncbitaxon:7160) | - | PubMed (25049052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-oct-2-enoic acid (CHEBI:86544) has role animal metabolite (CHEBI:75767) |
| (2E)-oct-2-enoic acid (CHEBI:86544) is a medium-chain fatty acid (CHEBI:59554) |
| (2E)-oct-2-enoic acid (CHEBI:86544) is a monounsaturated fatty acid (CHEBI:25413) |
| (2E)-oct-2-enoic acid (CHEBI:86544) is a olefinic fatty acid (CHEBI:53339) |
| (2E)-oct-2-enoic acid (CHEBI:86544) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-oct-2-enoic acid (CHEBI:86544) is conjugate acid of (2E)-oct-2-enoate (CHEBI:143526) |
| Incoming Relation(s) |
| (2E)-oct-2-enoate (CHEBI:143526) is conjugate base of (2E)-oct-2-enoic acid (CHEBI:86544) |
| IUPAC Name |
|---|
| (2E)-oct-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-octenoic acid | ChEBI |
| (E)-2-octenoic acid | HMDB |
| trans-2-octenoic acid | HMDB |
| trans-α-octenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001568 | HMDB |
| LMFA01030018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721115 | Reaxys |
| CAS:1871-67-6 | ChemIDplus |
| Citations |
|---|