EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O3 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 160.10994 |
| SMILES | CCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C8H16O3/c1-2-3-4-5-6-7(9)8(10)11/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | JKRDADVRIYVCCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyoctanoic acid (CHEBI:86543) has functional parent octanoic acid (CHEBI:28837) |
| 2-hydroxyoctanoic acid (CHEBI:86543) is a hydroxy fatty acid (CHEBI:24654) |
| 2-hydroxyoctanoic acid (CHEBI:86543) is conjugate acid of 2-hydroxyoctanoate (CHEBI:133514) |
| Incoming Relation(s) |
| 2-hydroxyoctanoyl-CoA (CHEBI:138941) has functional parent 2-hydroxyoctanoic acid (CHEBI:86543) |
| 2-hydroxyoctanoate (CHEBI:133514) is conjugate base of 2-hydroxyoctanoic acid (CHEBI:86543) |
| IUPAC Name |
|---|
| 2-hydroxyoctanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxycaprylic acid | ChEBI |
| α-hydroxyoctanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1760638 | Reaxys |
| CAS:617-73-2 | ChemIDplus |
| Citations |
|---|