EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2S |
| Net Charge | 0 |
| Average Mass | 206.314 |
| Monoisotopic Mass | 206.08777 |
| SMILES | CN1CCCN=C1/C=C/c1cccs1 |
| InChI | InChI=1S/C11H14N2S/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10/h2,4-6,9H,3,7-8H2,1H3/b6-5+ |
| InChIKey | YSAUAVHXTIETRK-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrantel (CHEBI:8654) has role antinematodal drug (CHEBI:35444) |
| pyrantel (CHEBI:8654) is a 1,4,5,6-tetrahydropyrimidines (CHEBI:78715) |
| pyrantel (CHEBI:8654) is a carboxamidine (CHEBI:35359) |
| pyrantel (CHEBI:8654) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 1-methyl-2-[(E)-2-(2-thienyl)vinyl]-1,4,5,6-tetrahydropyrimidine |
| INNs | Source |
|---|---|
| pirantel | WHO MedNet |
| pyrantel | ChemIDplus |
| pyrantel | WHO MedNet |
| pyrantelum | WHO MedNet |
| Citations |
|---|