EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O6 |
| Net Charge | 0 |
| Average Mass | 320.341 |
| Monoisotopic Mass | 320.12599 |
| SMILES | COc1cc(C(O)C(CO)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C17H20O6/c1-22-15-7-10(3-5-13(15)19)12(9-18)17(21)11-4-6-14(20)16(8-11)23-2/h3-8,12,17-21H,9H2,1-2H3 |
| InChIKey | DFUOJBWSSSODTR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia iwayomogi (ncbitaxon:265784) | aerial part (BTO:0001658) | DOI (10.1002/hlca.201300170.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-diguaiacylpropane-1,3-diol (CHEBI:86530) has role plant metabolite (CHEBI:76924) |
| 1,2-diguaiacylpropane-1,3-diol (CHEBI:86530) is a guaiacols (CHEBI:134251) |
| 1,2-diguaiacylpropane-1,3-diol (CHEBI:86530) is a propane-1,3-diols (CHEBI:26287) |
| IUPAC Name |
|---|
| 1,2-bis(4-hydroxy-3-methoxyphenyl)propane-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1892302 | Reaxys |