EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O3 |
| Net Charge | 0 |
| Average Mass | 168.192 |
| Monoisotopic Mass | 168.07864 |
| SMILES | COc1cccc(OC)c1OC |
| InChI | InChI=1S/C9H12O3/c1-10-7-5-4-6-8(11-2)9(7)12-3/h4-6H,1-3H3 |
| InChIKey | CRUILBNAQILVHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3-trimethoxybenzene (CHEBI:86529) has role plant metabolite (CHEBI:76924) |
| 1,2,3-trimethoxybenzene (CHEBI:86529) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 1,2,3-trimethoxybenzene |
| Synonyms | Source |
|---|---|
| pyrogallol trimethyl ether | ChEBI |
| methylsyringol | ChemIDplus |
| tri-O-methylpyrogallol | ChemIDplus |
| Citations |
|---|