EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H99NO8S |
| Net Charge | 0 |
| Average Mass | 874.408 |
| Monoisotopic Mass | 873.70914 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=S)N[C@@H](CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C50H99NO8S/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-39-45(60)51-42(41-58-50-49(57)48(56)47(55)44(40-52)59-50)46(54)43(53)38-36-34-32-30-28-16-14-12-10-8-6-4-2/h42-44,46-50,52-57H,3-41H2,1-2H3,(H,51,60)/t42-,43+,44+,46-,47-,48-,49+,50-/m0/s1 |
| InChIKey | MSKBSPRYFRAUPB-BYSUZVQFSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2S,3S,4R)-1-(α-D-galactosyloxy)-3,4-dihydroxyoctadecan-2-yl]hexacosanethioamide (CHEBI:86510) has functional parent 1-O-(α-D-galactosyl)-N-hexacosanoylphytosphingosine (CHEBI:466659) |
| N-[(2S,3S,4R)-1-(α-D-galactosyloxy)-3,4-dihydroxyoctadecan-2-yl]hexacosanethioamide (CHEBI:86510) has role antigen (CHEBI:59132) |
| N-[(2S,3S,4R)-1-(α-D-galactosyloxy)-3,4-dihydroxyoctadecan-2-yl]hexacosanethioamide (CHEBI:86510) is a glycosphingolipid (CHEBI:24402) |
| N-[(2S,3S,4R)-1-(α-D-galactosyloxy)-3,4-dihydroxyoctadecan-2-yl]hexacosanethioamide (CHEBI:86510) is a thiocarboxamide (CHEBI:47956) |
| IUPAC Name |
|---|
| N-[(2S,3S,4R)-1-(α-D-galactopyranosyloxy)-3,4-dihydroxyoctadecan-2-yl]hexacosanethioamide |
| Synonym | Source |
|---|---|
| DB06-1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4LX | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21391481 | Reaxys |
| Citations |
|---|